نام محصول |
Tripropylene glycol |
مترادف |
Tripropylene glycol (mixture of isomers); Tripropyleneglycol,90%; Tripropyleneglycol; TPG; 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol; 3,3'-[propane-1,2-diylbis(oxy)]dipropan-1-ol; tripropylene glycol, mixture of isomers |
میدان مغناطیسی |
C9H20O4 |
وزن مولکولی |
192.2527 |
InChI |
InChI=1/C9H20O4/c1-9(13-7-3-5-11)8-12-6-2-4-10/h9-11H,2-8H2,1H3 |
شماره سیایاس |
24800-44-0 |
تعداد کمیسیون اروپایی |
246-466-0 |
ساختار مولکولی |
|
تراکم |
1.038g/cm3 |
نقطه غلیان |
316.1°C at 760 mmHg |
ضریب شکست |
1.455 |
نقطه اشتعال |
145°C |
|