نام محصول |
Ethylene/vinyl acetate copolymer |
مترادف |
Poly(ethylene-co-vinyl acetate); Acetic Acid Ethenyl Ester, Polymer with Ethene; Ethylene-vinyl acetate copolymer; Ethylene/vinyl acetate copolymer, 14% vinyl acetate; Ethylene-vinyl acetate copolymer resin; Ethylene-vinyl acetate latex; Ethylene-vinyl acetate molding resin; eva; Ethylene Vinyl Acetate; but-3-enoic acid-ethene (1:1); VAE; VAP |
میدان مغناطیسی |
C6H10O2 |
وزن مولکولی |
114.1424 |
InChI |
InChI=1/C4H6O2.C2H4/c1-2-3-4(5)6;1-2/h2H,1,3H2,(H,5,6);1-2H2 |
شماره سیایاس |
24937-78-8 |
ساختار مولکولی |
|
نقطه ذوب |
99℃ |
نقطه غلیان |
170.6°C at 760 mmHg |
نقطه اشتعال |
68.2°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|