Nome del prodotto |
Ethyl 5-hydroxyindole-2-carboxylate |
Sinonimi |
5-Hydroxyindole-2-carboxylic acid ethyl ester; ethyl 5-hydroxy-1H-indole-2-carboxylate; (1-benzylpiperidin-3-yl)methanol |
Formula molecolare |
C13H19NO |
Peso Molecolare |
205.2961 |
InChI |
InChI=1/C13H19NO/c15-11-13-7-4-8-14(10-13)9-12-5-2-1-3-6-12/h1-3,5-6,13,15H,4,7-11H2 |
Numero CAS |
24985-85-1 |
EINECS |
246-554-9 |
Struttura molecolare |
|
Densità |
1.056g/cm3 |
Punto di ebollizione |
294.068°C at 760 mmHg |
Indice di rifrazione |
1.551 |
Punto d'infiammabilità |
123.378°C |
Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|