Ürün Adı |
diolein (C18:1,(cis)-9) |
Eş anlamlı |
Glyceryl dioleate; 9-Octadecenoic acid, diester with 1,2,3-propanetriol; Diolein; 9-Octadecenoic acid (9Z)-, diester with 1,2,3-propanetriol; 9-Octadecenoic acid (Z)-, diester with 1,2,3-propanetriol; Dioleic acid, diester with glycerol; 2-hydroxypropane-1,3-diyl bisoctadec-9-enoate; 3-hydroxypropane-1,2-diyl (9Z,9'Z)bis-octadec-9-enoate |
Moleküler Formülü |
C39H72O5 |
Molekül Ağırlığı |
620.986 |
InChI |
InChI=1/C39H72O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,40H,3-16,21-36H2,1-2H3/b19-17-,20-18- |
CAS kayıt numarası |
25637-84-7 |
EINECS |
247-144-2 |
Moleküler Yapısı |
|
Yoğunluk |
0.934g/cm3 |
Kaynama noktası |
670.8°C at 760 mmHg |
Kırılma indisi |
1.477 |
Alevlenme noktası |
186.3°C |
|