Naam product |
3,5-dibromo-4-hydroxybenzaldehyde oxime |
Synoniemen |
2,6-dibromo-4-[(E)-(hydroxyimino)methyl]phenol |
MF |
C7H5Br2NO2 |
Molecuulgewicht |
294.9281 |
InChI |
InChI=1/C7H5Br2NO2/c8-5-1-4(3-10-12)2-6(9)7(5)11/h1-3,11-12H/b10-3+ |
CAS-nummer |
25952-74-3 |
Moleculaire Structuur |
|
Dichtheid |
2.091g/cm3 |
Smeltpunt |
198℃ |
Kookpunt |
311.907°C at 760 mmHg |
Brekingsindex |
1.661 |
Vlampunt |
142.436°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|