product Name |
4-Acetoxy-3-methoxycinnamic acid |
Synonyms |
2-Propenoic acid, 3-(4-(acetyloxy)-3-methoxyphenyl)-; 3-Methoxy-4-acetoxycinnamic acid; AI3-23455; Acetylferulic acid; Cinnamic acid, 4-acetoxy-3-methoxy-; Cinnamic acid, 4-hydroxy-3-methoxy-, acetate; NSC 16957; 3-[4-(acetyloxy)-3-methoxyphenyl]prop-2-enoic acid; (2E)-3-[4-(acetyloxy)-3-methoxyphenyl]prop-2-enoic acid |
Molecular Formula |
C12H12O5 |
Molecular Weight |
236.2207 |
InChI |
InChI=1/C12H12O5/c1-8(13)17-10-5-3-9(4-6-12(14)15)7-11(10)16-2/h3-7H,1-2H3,(H,14,15)/b6-4+ |
CAS Registry Number |
2596-47-6 |
Molecular Structure |
|
Density |
1.265g/cm3 |
Boiling point |
371.9°C at 760 mmHg |
Refractive index |
1.575 |
Flash point |
141.6°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|