product Name |
1,2-Butanediol |
Synonyms |
.+/-.-1,2-Butanediol; 1,2-Butanediol, (.+/-.)-; Butane-1,2-diol; Butanediol, 1,2-; 1,2-Dihydroxybutane; 4-01-00-02507 (Beilstein Handbook Reference); AI3-07554; BRN 0969169; HSDB 1507; NSC 24242; alpha-Butylene glycol; alpha-Butyleneglycol; (2S)-butane-1,2-diol |
Molecular Formula |
C4H10O2 |
Molecular Weight |
90.121 |
InChI |
InChI=1/C4H10O2/c1-2-4(6)3-5/h4-6H,2-3H2,1H3 |
CAS Registry Number |
584-03-2;26171-83-5 |
EINECS |
209-527-2 |
Molecular Structure |
|
Density |
1.001g/cm3 |
Melting point |
-50℃ |
Boiling point |
190.3°C at 760 mmHg |
Refractive index |
1.437 |
Flash point |
93.3°C |
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|