Nama produk |
2-Iodobenzaldehyde |
Sinonim |
Benzaldehyde, 2-iodo- |
MF |
C7H5IO |
Berat Molekul |
232.0185 |
InChI |
InChI=1/C7H5IO/c8-7-4-2-1-3-6(7)5-9/h1-5H |
CAS NO |
26260-02-6 |
Struktur Molekul |
|
Kepadatan |
1.883g/cm3 |
Titik lebur |
36-39℃ |
Titik didih |
266.3°C at 760 mmHg |
Indeks bias |
1.668 |
Titik nyala |
114.8°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|