Produkt-Name |
3,5-diiodosalicylaldehyde |
Synonyme |
3,5-Diiodo-2-hydroxybenzaldehyde~2-Hydroxy-3,5-diiodobenzaldehyde; 2-hydroxy-3,5-diiodobenzaldehyde |
Molekulare Formel |
C7H4I2O2 |
Molecular Weight |
373.9144 |
InChI |
InChI=1/C7H4I2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H |
CAS Registry Number |
2631-77-8 |
EINECS |
220-117-2 |
Molecular Structure |
|
Dichte |
2.602g/cm3 |
Schmelzpunkt |
109-110℃ |
Siedepunkt |
304.6°C at 760 mmHg |
Brechungsindex |
1.787 |
Flammpunkt |
138°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|