Ürün Adı |
(1R)-(-)-Menthyl glyoxylate hydrate |
Eş anlamlı |
Glyoxylic acid (1R)-menthyl ester hydrate; (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl oxoacetate |
Moleküler Formülü |
C12H20O3 |
Molekül Ağırlığı |
212.2854 |
InChI |
InChI=1/C12H20O3/c1-8(2)10-5-4-9(3)6-11(10)15-12(14)7-13/h7-11H,4-6H2,1-3H3/t9-,10+,11-/m1/s1 |
CAS kayıt numarası |
26315-61-7 |
Moleküler Yapısı |
|
Yoğunluk |
1g/cm3 |
Kaynama noktası |
282°C at 760 mmHg |
Kırılma indisi |
1.458 |
Alevlenme noktası |
116.5°C |
Risk Kodları |
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
Güvenlik Açıklaması |
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|