produktnavn |
(R)-12-hydroxyoleic acid, monoester with propane-1,2-diol |
Synonymer |
12-Hydroxy-9-octadecenoic acid, monoester with 1,2-propanediol; 9-Octadecenoic acid, 12-hydroxy-, monoester with 1,2-propanediol; Propylene glycol monoricinoleate; Propylene glycol ricinoleate; (R)-12-Hydroxyoleic acid, monoester with propane-1,2-diol; 9-Octadecenoic acid, 12-hydroxy-, monoester with 1,2-propanediol, (9Z,12R)-; 2-hydroxypropyl 12-hydroxyoctadec-9-enoate; 2-hydroxypropyl (9Z)-12-hydroxyoctadec-9-enoate |
Molekylær Formel |
C21H40O4 |
Molekylvekt |
356.5399 |
InChI |
InChI=1/C21H40O4/c1-3-4-5-12-15-20(23)16-13-10-8-6-7-9-11-14-17-21(24)25-18-19(2)22/h10,13,19-20,22-23H,3-9,11-12,14-18H2,1-2H3/b13-10- |
CAS-nummer |
26402-31-3 |
EINECS |
247-669-7 |
Molecular Structure |
|
Tetthet |
0.968g/cm3 |
Kokepunkt |
481.1°C at 760 mmHg |
Brytningsindeks |
1.477 |
Flammepunktet |
154.5°C |
|