product Name |
2,2-Dichloroacetophenone |
Synonyms |
2,2-Dichloro-1-phenylethanone; alpha,alpha-Dichloroacetophenone; Phenacylidene chloride |
Molecular Formula |
C8H6Cl2O |
Molecular Weight |
189.0386 |
InChI |
InChI=1/C8H6Cl2O/c9-8(10)7(11)6-4-2-1-3-5-6/h1-5,8H |
CAS Registry Number |
2648-61-5 |
Molecular Structure |
|
Density |
1.311g/cm3 |
Melting point |
21℃ |
Boiling point |
252.3°C at 760 mmHg |
Refractive index |
1.55 |
Flash point |
103.6°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|