اسم المنتج |
Formaldehyde, oligomeric reaction products with 5,5-dimethyl-2,4-imidazolidinedione |
الاسم المستعار |
Dimethyl hydantoin formaldehyde resin; 2,4-Imidazolidinedione, dimethyl-, polymer with formaldehyde; DMHF; Dimethylhydantoin-formaldehyde resin; Formaldehyde, polymer with 5,5-dimethyl-2,4-imidazolidinedione; 5,5-dimethylimidazolidine-2,4-dione - formaldehyde (1:1) |
الصيغة الجزيئية |
C6H10N2O3 |
الوزن الجزيئي الغرامي |
158.1552 |
InChI |
InChI=1/C5H8N2O2.CH2O/c1-5(2)3(8)6-4(9)7-5;1-2/h1-2H3,(H2,6,7,8,9);1H2 |
إستراتيجية المساعدة القطرية |
26811-08-5 |
المفوضية الأوروبية رقم |
500-052-9 |
بنية جزيئية |
|
نقطة الغليان |
244.1°C at 760 mmHg |
نقطة الوميض |
106.6°C |
|