Naam product |
Benzylidenemalononitrile |
Synoniemen |
beta,beta-styrenedicarbonitrile; Benzalmalononitrile; 2-benzylidenemalononitrile; benzylidenepropanedinitrile |
MF |
C10H6N2 |
Molecuulgewicht |
154.168 |
InChI |
InChI=1/C10H6N2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-6H |
CAS-nummer |
2700-22-3 |
EINECS |
220-283-6 |
Moleculaire Structuur |
|
Dichtheid |
1.154g/cm3 |
Smeltpunt |
82-86℃ |
Kookpunt |
294.8°C at 760 mmHg |
Brekingsindex |
1.612 |
Vlampunt |
138°C |
Gevaarsymbolen |
T:Toxic;
|
Risico-codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|