product Name |
4-fluoroglutamic acid |
Synonyms |
4-Fluoro-DL-glutamic acid; DL-4-Fluoroglutamic acid; H-4-F-DL-Glu-OH; 4-fluoro-L-glutamic acid |
Molecular Formula |
C5H8FNO4 |
Molecular Weight |
165.1197 |
InChI |
InChI=1/C5H8FNO4/c6-2(4(8)9)1-3(7)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)/t2?,3-/m0/s1 |
CAS Registry Number |
2708-77-2 |
EINECS |
220-302-8 |
Molecular Structure |
|
Density |
1.498g/cm3 |
Boiling point |
342.4°C at 760 mmHg |
Refractive index |
1.491 |
Flash point |
160.9°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|