product Name |
4-Acetamido-acetophenone |
Synonyms |
4-Acetylacetanilide~N,4-Diacetylaniline; 4-Acetamidoacetophenone; N-(4-acetylphenyl)acetamide |
Molecular Formula |
C10H11NO2 |
Molecular Weight |
177.1998 |
InChI |
InChI=1/C10H11NO2/c1-7(12)9-3-5-10(6-4-9)11-8(2)13/h3-6H,1-2H3,(H,11,13) |
CAS Registry Number |
2719-21-3 |
EINECS |
220-320-6 |
Molecular Structure |
|
Density |
1.15g/cm3 |
Melting point |
164-166℃ |
Boiling point |
390.3°C at 760 mmHg |
Refractive index |
1.57 |
Flash point |
177.3°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|