Nome del prodotto |
3-Formylfuran-2-boronic acid |
Sinonimi |
2-Borono-3-furaldehyde; (3-formylfuran-2-yl)boronic acid |
Formula molecolare |
C5H5BO4 |
Peso Molecolare |
139.9018 |
InChI |
InChI=1/C5H5BO4/c7-3-4-1-2-10-5(4)6(8)9/h1-3,8-9H |
Numero CAS |
27339-38-4 |
Struttura molecolare |
|
Densità |
1.36g/cm3 |
Punto di ebollizione |
346.6°C at 760 mmHg |
Indice di rifrazione |
1.51 |
Punto d'infiammabilità |
163.4°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|