Nazwa produktu: |
ethyl trans-2-hexenoate |
Synonimy |
trans-2-Hexenoic acid ethyl ester; ethyl (2E)-hex-2-enoate; Ethyl (E)-Hex-2-Enoate |
MF |
C8H14O2 |
Masie cząsteczkowej |
142.1956 |
InChI |
InChI=1/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h6-7H,3-5H2,1-2H3/b7-6+ |
Nr CAS |
27829-72-7 |
EINECS |
248-681-5 |
Struktury molekularnej |
|
Gęstość |
0.901g/cm3 |
Temperatura wrzenia |
172.6°C at 760 mmHg |
Współczynnik załamania |
1.432 |
Temperatura zapłonu |
62.3°C |
Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|