Produkt-Name |
2-(Ethylthio)nicotinic acid |
Synonyme |
2-(Ethylmercapto)nicotinic acid~2-(Ethylthio)pyridine-3-carboxylic acid; 2-(ethylsulfanyl)pyridine-3-carboxylic acid |
Molekulare Formel |
C8H9NO2S |
Molecular Weight |
183.2276 |
InChI |
InChI=1/C8H9NO2S/c1-2-12-7-6(8(10)11)4-3-5-9-7/h3-5H,2H2,1H3,(H,10,11) |
CAS Registry Number |
27868-76-4 |
Molecular Structure |
|
Dichte |
1.3g/cm3 |
Schmelzpunkt |
185-187℃ |
Siedepunkt |
338.6°C at 760 mmHg |
Brechungsindex |
1.599 |
Flammpunkt |
158.6°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|