상품명칭 |
Cyclooctene oxide |
별명 |
9-Oxabicyclo[6.1.0]nonane; Epoxycyclooctane~2-Oxabicyclo[6.1.0]nonane; Epoxycyclooctane; (1R,8S)-9-oxabicyclo[6.1.0]nonane; (1R,8R)-9-oxabicyclo[6.1.0]nonane; (1S,8S)-9-oxabicyclo[6.1.0]nonane |
분자식 |
C8H14O |
분자량 |
126.1962 |
InChI |
InChI=1/C8H14O/c1-2-4-6-8-7(9-8)5-3-1/h7-8H,1-6H2/t7-,8-/m0/s1 |
cas번호 |
286-62-4 |
EC번호 |
206-010-3 |
분자 구조 |
|
밀도 |
0.958g/cm3 |
녹는 점 |
53-56℃ |
비등점 |
189.3°C at 760 mmHg |
굴절 지수 |
1.466 |
인화점 |
56.1°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|