상품명칭 |
2,3-Dichlorobenzoyl Chloride |
별명 |
2,3-Dichloro benzoic acid; dichlorobenzoyl chloride; Benzoyl chloride, dichloro-; Benzoyl chloride, 2,3-dichloro-; 2,3-Dichlorobenzoylchloride; 2,3-Dichloro benzoic Chloride |
분자식 |
C7H3Cl3O |
분자량 |
209.46 |
InChI |
InChI=1/C7H3Cl3O/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H |
cas번호 |
2905-60-4;25134-08-1 |
EC번호 |
220-811-5 |
분자 구조 |
|
밀도 |
14014 |
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|