Produkt-Name |
myristic acid, monoester with propane-1,2-diol |
Synonyme |
Propylene glycol monomyristate; Propylene glycol myristate; Tetradecanoic acid, monoester with 1,2-propanediol; Myristic acid, monoester with propane-1,2-diol; 2-hydroxypropyl tetradecanoate |
Molekulare Formel |
C17H34O3 |
Molecular Weight |
286.4501 |
InChI |
InChI=1/C17H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-17(19)20-15-16(2)18/h16,18H,3-15H2,1-2H3 |
CAS Registry Number |
29059-24-3 |
EINECS |
249-395-3 |
Molecular Structure |
|
Dichte |
0.922g/cm3 |
Siedepunkt |
392.2°C at 760 mmHg |
Brechungsindex |
1.453 |
Flammpunkt |
149.1°C |
|