Naam product |
4,4'-Dithiodibutyric acid |
Synoniemen |
Dithiodibutyricacid; 4,4-Dithiodibutyric acid; Bis(3-carboxypropyl) disulphide~3-Carboxypropyl disulphide; 3-Carboxypropyl disulfide; 4,4'-disulfanediyldibutanoic acid; 4,4'-disulfanediyldibutanoate |
MF |
C8H12O4S2 |
Molecuulgewicht |
236.3096 |
InChI |
InChI=1/C8H14O4S2/c9-7(10)3-1-5-13-14-6-2-4-8(11)12/h1-6H2,(H,9,10)(H,11,12)/p-2 |
CAS-nummer |
2906-60-7 |
EINECS |
220-818-3 |
Moleculaire Structuur |
|
Smeltpunt |
105-110℃ |
Kookpunt |
467.1°C at 760 mmHg |
Vlampunt |
236.3°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|