نام محصول |
2,3-Dimethylphenoxyacetic acid |
مترادف |
2,3-Xylyloxyacetic acid; (2,3-dimethylphenoxy)acetate |
میدان مغناطیسی |
C10H11O3 |
وزن مولکولی |
179.1931 |
InChI |
InChI=1/C10H12O3/c1-7-4-3-5-9(8(7)2)13-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
شماره سیایاس |
2935-63-9 |
تعداد کمیسیون اروپایی |
220-911-9 |
ساختار مولکولی |
|
نقطه غلیان |
315.2°C at 760 mmHg |
نقطه اشتعال |
124.3°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|