Nazwa produktu: |
Methyl 5-methylnicotinate |
Synonimy |
Methyl 5-methylpyridine-3-carboxylate; 5-Methylnicotinic acid methyl ester; 5-Methyl-nicotinic acid methyl ester |
MF |
C8H9NO2 |
Masie cząsteczkowej |
151.1626 |
InChI |
InChI=1/C8H9NO2/c1-6-3-7(5-9-4-6)8(10)11-2/h3-5H,1-2H3 |
Nr CAS |
29681-45-6 |
Struktury molekularnej |
|
Gęstość |
1.104g/cm3 |
Temperatura wrzenia |
228.5°C at 760 mmHg |
Współczynnik załamania |
1.51 |
Temperatura zapłonu |
92°C |
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|