상품명칭 |
2-Bromopyridine-4-carboxamide |
별명 |
2-Bromoisonicotinamide |
분자식 |
C6H5BrN2O |
분자량 |
201.0207 |
InChI |
InChI=1/C6H5BrN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
cas번호 |
29840-73-1 |
분자 구조 |
|
밀도 |
1.71g/cm3 |
비등점 |
338.1°C at 760 mmHg |
굴절 지수 |
1.613 |
인화점 |
158.3°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|