상품명칭 |
4-Dimethylamino-4'-methylazobenzene |
별명 |
Aniline, N,N-dimethyl-4-(p-tolylazo)-; 4'-Methyl-4-dimethylaminoazobenzene; 4'-Methyl-p-dimethylaminoazobenzene; Benzenamine, N,N-dimethyl-4-((4-methylphenyl)azo)-; N,N-Dimethyl-p-(p-tolylazo)aniline; NSC 204514; p'-Methyl-p-dimethylaminoazobenzene; Aniline, N,N-dimethyl-p-(p-tolylazo)- (8CI); Benzenamine, N,N-dimethyl-4-((4-methylphenyl)azo)- (9CI); N,N-Dimethyl-4-(p-tolylazo)aniline; N,N-dimethyl-4-[(E)-(4-methylphenyl)diazenyl]aniline |
분자식 |
C15H17N3 |
분자량 |
239.3156 |
InChI |
InChI=1/C15H17N3/c1-12-4-6-13(7-5-12)16-17-14-8-10-15(11-9-14)18(2)3/h4-11H,1-3H3/b17-16+ |
cas번호 |
3010-57-9 |
EC번호 |
221-135-3 |
분자 구조 |
|
밀도 |
1.01g/cm3 |
녹는 점 |
166℃ |
비등점 |
387.4°C at 760 mmHg |
굴절 지수 |
1.561 |
인화점 |
188.1°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R40:Possible risks of irreversible effects.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|