نام محصول |
Isopropylthiobenzene |
مترادف |
(Isopropylthio)benzene; Isopropyl phenyl sulphide; (propan-2-ylsulfanyl)benzene |
میدان مغناطیسی |
C9H12S |
وزن مولکولی |
152.2566 |
InChI |
InChI=1/C9H12S/c1-8(2)10-9-6-4-3-5-7-9/h3-8H,1-2H3 |
شماره سیایاس |
3019-20-3 |
تعداد کمیسیون اروپایی |
221-162-0 |
ساختار مولکولی |
|
تراکم |
0.98g/cm3 |
نقطه غلیان |
208°C at 760 mmHg |
ضریب شکست |
1.544 |
نقطه اشتعال |
83.2°C |
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|