Naam product |
6-methoxyflavanone |
Synoniemen |
6-Methoxyflavanone; 2,3-Dihydro-6-methoxy-2-phenyl-4H-1-benzopyran-4-one; NSC 50184; 4H-1-Benzopyran-4-one, 2,3-dihydro-6-methoxy-2-phenyl-; 6-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2S)-6-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2R)-6-methoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
MF |
C16H14O3 |
Molecuulgewicht |
254.2806 |
InChI |
InChI=1/C16H14O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-9,16H,10H2,1H3/t16-/m1/s1 |
CAS-nummer |
3034-04-6 |
Moleculaire Structuur |
|
Dichtheid |
1.199g/cm3 |
Smeltpunt |
141-143℃ |
Kookpunt |
425.5°C at 760 mmHg |
Brekingsindex |
1.587 |
Vlampunt |
202.9°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|