Naam product |
2,5-Dichlorophenylhydrazine |
Synoniemen |
-2,5-DICHLOROPHENYLHYDRAZINE; 1-(2,5-DICHLOROPHENYL)HYDRAZINE; (2,5-dichlorophenyl)-hydrazin; Hydrazine, (2,5-dichlorophenyl)-; 2,5-DICHLOROPHENYLHYRAZINE |
MF |
C6H6Cl2N2 |
Molecuulgewicht |
177.0312 |
InChI |
InChI=1/C6H6Cl2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
CAS-nummer |
305-15-7 |
EINECS |
206-163-6 |
Moleculaire Structuur |
|
Dichtheid |
1.475g/cm3 |
Smeltpunt |
100-104℃ |
Kookpunt |
266.8°C at 760 mmHg |
Brekingsindex |
1.665 |
Vlampunt |
115.1°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|