Iodoacetic acid, sodium salt

نام محصول	Iodoacetic acid, sodium salt
مترادف	Sodium iodoacetate; Iodoacetic acid sodium salt
میدان مغناطیسی	C₂H₂INaO₂
وزن مولکولی	207.9303
InChI	InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1
شماره سیایاس	305-53-3
تعداد کمیسیون اروپایی	206-165-7
ساختار مولکولی
نقطه ذوب	208-210℃
نقطه غلیان	262.1°C at 760 mmHg
نقطه اشتعال	112.3°C
خطر نمادها	T:Toxic;
کدهای خطر	R25:Toxic if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.;
توضیحات ایمنی	S22:Do not inhale dust.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;