نام محصول |
Iodoacetic acid, sodium salt |
مترادف |
Sodium iodoacetate; Iodoacetic acid sodium salt |
میدان مغناطیسی |
C2H2INaO2 |
وزن مولکولی |
207.9303 |
InChI |
InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
شماره سیایاس |
305-53-3 |
تعداد کمیسیون اروپایی |
206-165-7 |
ساختار مولکولی |
|
نقطه ذوب |
208-210℃ |
نقطه غلیان |
262.1°C at 760 mmHg |
نقطه اشتعال |
112.3°C |
خطر نمادها |
T:Toxic;
|
کدهای خطر |
R25:Toxic if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|