Nama produk |
sym-Dimethylhydrazine dihydrochloride |
Sinonim |
1,2-Dimethylhydrazine dihydrochloride; 1,2-dimethylhydrazine; 1,1-dimethylhydrazine dihydrochloride |
MF |
C2H10Cl2N2 |
Berat Molekul |
133.0202 |
InChI |
InChI=1/C2H8N2.2ClH/c1-4(2)3;;/h3H2,1-2H3;2*1H |
CAS NO |
306-37-6 |
EINECS |
206-183-5 |
Struktur Molekul |
|
Titik lebur |
166-167℃ |
Titik didih |
63.9°C at 760 mmHg |
Titik nyala |
1.1°C |
Simbol bahaya |
T:Toxic;
|
Kode Risiko |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R45:May cause cancer.;
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|