Produkt-Name |
2-bromo-1-[5-(2-pyridinyl)-2-thienyl]-1-ethanone |
Synonyme |
2-bromo-1-(5-pyridin-2-ylthiophen-2-yl)ethanone |
Molekulare Formel |
C11H8BrNOS |
Molecular Weight |
282.1563 |
InChI |
InChI=1/C11H8BrNOS/c12-7-9(14)11-5-4-10(15-11)8-3-1-2-6-13-8/h1-6H,7H2 |
CAS Registry Number |
306935-06-8 |
Molecular Structure |
|
Dichte |
1.549g/cm3 |
Schmelzpunkt |
122℃ |
Siedepunkt |
421.7°C at 760 mmHg |
Brechungsindex |
1.633 |
Flammpunkt |
208.8°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|