product Name |
N-(2-Cyanoethyl)glycine |
Synonyms |
N-(2-Cyanoehtyl)glycine |
Molecular Formula |
C5H8N2O2 |
Molecular Weight |
128.1292 |
InChI |
InChI=1/C5H8N2O2/c6-2-1-3-7-4-5(8)9/h7H,1,3-4H2,(H,8,9) |
CAS Registry Number |
3088-42-4 |
EINECS |
221-418-1 |
Molecular Structure |
|
Density |
1.187g/cm3 |
Melting point |
188-193℃ |
Boiling point |
343.1°C at 760 mmHg |
Refractive index |
1.473 |
Flash point |
161.3°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|