نام محصول |
Glycolaldehyde dimethyl acetal |
مترادف |
2,2-Dimethoxyethanol~Hydroxyacetaldehyde dimethyl acetal; 2,2-Dimethoxyethanol; 2,3-dimethoxy ethanol |
میدان مغناطیسی |
C4H10O3 |
وزن مولکولی |
106.1204 |
InChI |
InChI=1/C4H10O3/c1-6-4(3-5)7-2/h4-5H,3H2,1-2H3 |
شماره سیایاس |
30934-97-5 |
تعداد کمیسیون اروپایی |
250-398-7 |
ساختار مولکولی |
|
تراکم |
1.009g/cm3 |
نقطه غلیان |
146.1°C at 760 mmHg |
ضریب شکست |
1.401 |
نقطه اشتعال |
42.2°C |
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|