Cinnamicacid vinylester

اسم المنتج	Cinnamicacid vinylester
الاسم المستعار	Cinnamic acid vinyl ester; Vinyl cinnamate, (Cinnamic acid vinyl ester); Vinyl cinnamate; ethenyl 3-phenylprop-2-enoate; ethenyl (2E)-3-phenylprop-2-enoate
الصيغة الجزيئية	C₁₁H₁₀O₂
الوزن الجزيئي الغرامي	174.1959
InChI	InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h2-9H,1H2/b9-8+
إستراتيجية المساعدة القطرية	3098-92-8
بنية جزيئية
كثافة	1.075g/cm³
نقطة الغليان	267°C at 760 mmHg
معامل الإنكسار	1.566
نقطة الوميض	105.9°C
خطر المصطلحات	R36/38:Irritating to eyes and skin.;
شروط الأمن	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;