Nama produk |
o-Cresotic Hydrazide |
Sinonim |
2-Hydroxy-3-methylbenzhydrazide; 3-Methylsalicylhydrazide; 2-hydroxy-3-methylbenzohydrazide |
MF |
C8H10N2O2 |
Berat Molekul |
166.1772 |
InChI |
InChI=1/C8H10N2O2/c1-5-3-2-4-6(7(5)11)8(12)10-9/h2-4,11H,9H2,1H3,(H,10,12) |
CAS NO |
30991-42-5 |
Struktur Molekul |
|
Kepadatan |
1.262g/cm3 |
Indeks bias |
1.607 |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|