Nama produk |
5-methyl-2-nitrobenzoic acid |
Sinonim |
6-Nitro-m-toluic acid; 2-Nitro-5-Methylbenzoicacid; 2-Nitro-5-methylbenzoic acid |
MF |
C8H7NO4 |
Berat Molekul |
181.1455 |
InChI |
InChI=1/C8H7NO4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
CAS NO |
3113-72-2 |
EINECS |
221-481-5 |
Struktur Molekul |
|
Kepadatan |
1.392g/cm3 |
Titik lebur |
134-136℃ |
Titik didih |
367.6°C at 760 mmHg |
Indeks bias |
1.6 |
Titik nyala |
166.8°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|