product Name |
5-Acetylvaleric acid |
Synonyms |
6-Oxoheptanoic acid; 6-Ketoheptanoic acid~6-Oxoheptanoic acid; 6-oxoheptanoate; 6-Oxoenanthic acid |
Molecular Formula |
C7H11O3 |
Molecular Weight |
143.161 |
InChI |
InChI=1/C7H12O3/c1-6(8)4-2-3-5-7(9)10/h2-5H2,1H3,(H,9,10)/p-1 |
CAS Registry Number |
3128-07-2 |
EINECS |
221-512-2 |
Molecular Structure |
|
Melting point |
34-140℃ |
Boiling point |
299.3°C at 760 mmHg |
Flash point |
149.1°C |
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|