Ονομασία του προϊόντος |
Methyl 2,4,6-trihydroxybenzoate |
Συνώνυμα |
2,4,6-Trihydroxybenzoic acid methyl ester; Phloroglucinolcarboxylic acid methyl ester |
MF |
C8H8O5 |
Μοριακό βάρος |
184.1461 |
InChI |
InChI=1/C8H8O5/c1-13-8(12)7-5(10)2-4(9)3-6(7)11/h2-3,9-11H,1H3 |
CAS ΟΧΙ |
3147-39-5 |
EINECS |
221-566-7 |
Μοριακή δομή |
|
Πυκνότητα |
1.501g/cm3 |
Σημείο τήξης |
174-176℃ |
Σημείο βρασμού |
359.5°C at 760 mmHg |
Δείκτης διάθλασης |
1.63 |
Σημείο ανάφλεξης |
150.3°C |
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|