Nazwa produktu: |
4-Hydroxybenzal Acetone |
Synonimy |
4-Hydroxybenzylidenacetone; 4-Hydroxybenzylideneacetone; 4-(4-hydroxyphenyl)but-3-en-2-one; (3E)-4-(4-hydroxyphenyl)but-3-en-2-one |
MF |
C10H10O2 |
Masie czÄ…steczkowej |
162.1852 |
InChI |
InChI=1/C10H10O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h2-7,12H,1H3/b3-2+ |
Nr CAS |
3160-35-8 |
EINECS |
221-607-9 |
Struktury molekularnej |
|
Gęstość |
1.138g/cm3 |
Temperatura wrzenia |
318.1°C at 760 mmHg |
Współczynnik załamania |
1.599 |
Temperatura zapłonu |
134.8°C |
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|