Produkt-Name |
4'-Bromo-3-chloropropiophenone |
Synonyme |
4-Bromo-beta-chloropropiophenone; 1-(4-bromophenyl)-3-chloropropan-1-one |
Molekulare Formel |
C7H4BrClO2 |
Molecular Weight |
235.4625 |
InChI |
InChI=1/C7H4BrClO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H,10,11) |
CAS Registry Number |
31736-73-9 |
EINECS |
250-784-5 |
Molecular Structure |
|
Dichte |
1.809g/cm3 |
Schmelzpunkt |
58-61℃ |
Siedepunkt |
347.4°C at 760 mmHg |
Brechungsindex |
1.621 |
Flammpunkt |
163.9°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|