Naam product |
4-Methoxy-3-nitropyridine hydrochloride |
Synoniemen |
3-Nitro-4-methoxypyridine hydrochloride; 4-methoxy-3-nitropyridine hydrochloride (1:1) |
MF |
C6H7N2O3Cl |
Molecuulgewicht |
190.5861 |
InChI |
InChI:1S/C6H6N2O3.ClH/c1-11-6-2-3-7-4-5(6)8(9)10;/h2-4H,1H3;1H |
CAS-nummer |
31872-61-4 |
Moleculaire Structuur |
|
Dichtheid |
1.3g/cm3 |
Kookpunt |
275.9°C at 760 mmHg |
Brekingsindex |
1.546 |
Vlampunt |
120.7°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|