produktnavn |
2-Furoylacetonitrile |
Synonymer |
3-(furan-2-yl)-3-oxopropanenitrile |
Molekylær Formel |
C7H5NO2 |
Molekylvekt |
135.1201 |
InChI |
InChI=1/C7H5NO2/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
CAS-nummer |
31909-58-7 |
Molecular Structure |
|
Tetthet |
1.188g/cm3 |
Smeltepunkt |
76-83℃ |
Kokepunkt |
297.2°C at 760 mmHg |
Brytningsindeks |
1.494 |
Flammepunktet |
133.6°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|