produktnavn |
Norephedrine hydrochloride |
Synonymer |
Phenylpropanolamine hydrochloride; 2-Amino-1-phenyl-1-propanol hydrochloride; 2-amino-1-phenylpropan-1-ol |
Molekylær Formel |
C9H13NO |
Molekylvekt |
151.2056 |
InChI |
InChI=1/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3 |
CAS-nummer |
3198-15-0 |
EINECS |
221-702-5 |
Molecular Structure |
|
Tetthet |
1.071g/cm3 |
Smeltepunkt |
194-197℃ |
Kokepunkt |
288.1°C at 760 mmHg |
Brytningsindeks |
1.557 |
Flammepunktet |
128.1°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R22:Harmful if swallowed.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|