Produkt-Name |
4,4''-Dinitro-p-terphenyl |
Synonyme |
p-Terphenyl, 4,4''-dinitro-; 4,4''-dinitro-1,1':4',1''-terphenyl |
Molekulare Formel |
C18H12N2O4 |
Molecular Weight |
320.2989 |
InChI |
InChI=1/C18H12N2O4/c21-19(22)17-9-5-15(6-10-17)13-1-2-14(4-3-13)16-7-11-18(12-8-16)20(23)24/h1-12H |
CAS Registry Number |
3282-11-9 |
Molecular Structure |
|
Dichte |
1.314g/cm3 |
Siedepunkt |
534.4°C at 760 mmHg |
Brechungsindex |
1.646 |
Flammpunkt |
260.2°C |
Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|