Nome del prodotto |
6-Chloro-2-fluoro-3-methylbenzoic acid |
Sinonimi |
6-Chloro-2-fluoro-m-toluic acid |
Formula molecolare |
C8H6ClFO2 |
Peso Molecolare |
188.5834 |
InChI |
InChI=1/C8H6ClFO2/c1-4-2-3-5(9)6(7(4)10)8(11)12/h2-3H,1H3,(H,11,12) |
Numero CAS |
32890-90-7 |
Struttura molecolare |
|
Densità |
1.403g/cm3 |
Punto di ebollizione |
279.7°C at 760 mmHg |
Indice di rifrazione |
1.551 |
Punto d'infiammabilità |
123°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|