اسم المنتج |
Methyl methylsulfinylmethyl sulfide |
الاسم المستعار |
Methyl (methylthio)methyl sulphoxide; MMTS; Formaldehyde dimethyl thioacetal monoxide; Methyl (methylsulphinyl)methyl sulphide; (methylsulfanyl)(methylsulfinyl)methane; (methylsulfanyl)[(R)-methylsulfinyl]methane; (methylsulfanyl)[(S)-methylsulfinyl]methane |
الصيغة الجزيئية |
C3H8OS2 |
الوزن الجزيئي الغرامي |
124.225 |
InChI |
InChI=1/C3H8OS2/c1-5-3-6(2)4/h3H2,1-2H3/t6-/m0/s1 |
إستراتيجية المساعدة القطرية |
33577-16-1 |
المفوضية الأوروبية رقم |
251-577-2 |
بنية جزيئية |
|
كثافة |
1.223g/cm3 |
درجة الإنصهار |
222-226℃ |
نقطة الغليان |
257.772°C at 760 mmHg |
معامل الإنكسار |
1.56 |
نقطة الوميض |
121.4°C |
شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|