اسم المنتج |
hydroxyoctadecanoic acid, monoester with propane-1,2-diol |
الاسم المستعار |
Octadecanoic acid, 12-hydroxy-, monoester with 1,2-propanediol; Propylene glycol hydroxystearate; Hydroxyoctadecanoic acid, monoester with propane-1,2-diol; 2-hydroxyoctadecanoate; propane-1,2-diol |
الصيغة الجزيئية |
C21H43O5 |
الوزن الجزيئي الغرامي |
375.5637 |
InChI |
InChI=1/C18H36O3.C3H8O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21;1-3(5)2-4/h17,19H,2-16H2,1H3,(H,20,21);3-5H,2H2,1H3/p-1 |
إستراتيجية المساعدة القطرية |
33907-47-0 |
المفوضية الأوروبية رقم |
251-734-5 |
بنية جزيئية |
|
نقطة الغليان |
432.6°C at 760 mmHg |
نقطة الوميض |
229.6°C |
|