Triphenylcarbenium tetrafluoroborate

اسم المنتج	Triphenylcarbenium tetrafluoroborate
الاسم المستعار	Trityl fluoroborate; Tritylium tetrafluoroborate; Trityl tetrafluoroborate; triphenylmethylium tetrafluoroborate
الصيغة الجزيئية	C₁₉H₁₅BF₄
الوزن الجزيئي الغرامي	330.127
InChI	InChI=1/C19H15.BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)5/h1-15H;/q+1;-1
إستراتيجية المساعدة القطرية	341-02-6
المفوضية الأوروبية رقم	206-433-3
بنية جزيئية
درجة الإنصهار	205-215℃
علامات على البضائع الخطرة	C:Corrosive;
خطر المصطلحات	R34:Causes burns.;
شروط الأمن	S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;